C15H16F3N3O2 — CID 111475536
1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxycyclohexyl)urea (PubChem CID 111475536) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxycyclohexyl)urea.
| Compound Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 111475536 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[4-cyano-3-(trifluoromethyl)phenyl]-3-(2-hydroxycyclohexyl)urea |
| SMILES | N#Cc1ccc(NC(=O)NC2CCCCC2O)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)11-7-10(6-5-9(11)8-19)20-14(23)21-12-3-1-2-4-13(12)22/h5-7,12-13,22H,1-4H2,(H2,20,21,23) |
| InChIKey | QBRSRXPJOAIVPJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |