C18H22N4O2 — CID 124504703
1-(3-acetylphenyl)-3-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]urea (PubChem CID 124504703) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]urea |
|---|---|
| PubChem CID | 124504703 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]urea |
| SMILES | CC(=O)c1cccc(NC(=O)N[C@@H]2CCCC[C@H]2n2cccn2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-13(23)14-6-4-7-15(12-14)20-18(24)21-16-8-2-3-9-17(16)22-11-5-10-19-22/h4-7,10-12,16-17H,2-3,8-9H2,1H3,(H2,20,21,24)/t16-,17-/m1/s1 |
| InChIKey | CTKJGOPWGAZRCE-IAGOWNOFSA-N |
| XLogP | 3.39 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |