C17H22N4O2 — CID 96525273
1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-(3-pyrazol-1-ylphenyl)urea (PubChem CID 96525273) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-(3-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-(3-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 96525273 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-(3-pyrazol-1-ylphenyl)urea |
| SMILES | O=C(Nc1cccc(-n2cccn2)c1)N[C@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C17H22N4O2/c22-12-13-5-1-2-8-16(13)20-17(23)19-14-6-3-7-15(11-14)21-10-4-9-18-21/h3-4,6-7,9-11,13,16,22H,1-2,5,8,12H2,(H2,19,20,23)/t13-,16-/m0/s1 |
| InChIKey | OARSBKUZRXUKOS-BBRMVZONSA-N |
| XLogP | 2.54 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |