C19H26N4O2 — CID 96569194
1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]urea (PubChem CID 96569194) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]urea.
| Compound Name | 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 96569194 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(-n2cccn2)cc1)N[C@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C19H26N4O2/c24-14-16-4-1-2-5-18(16)22-19(25)20-12-10-15-6-8-17(9-7-15)23-13-3-11-21-23/h3,6-9,11,13,16,18,24H,1-2,4-5,10,12,14H2,(H2,20,22,25)/t16-,18-/m0/s1 |
| InChIKey | HLFLFIDUOQEYGF-WMZOPIPTSA-N |
| XLogP | 2.27 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |