C18H23N5O — CID 47042960
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-(3-pyrazol-1-ylphenyl)urea (PubChem CID 47042960) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-(3-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-(3-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 47042960 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-(3-pyrazol-1-ylphenyl)urea |
| SMILES | O=C(Nc1cccc(-n2cccn2)c1)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C18H23N5O/c24-18(21-16-8-12-22-10-2-1-7-17(16)22)20-14-5-3-6-15(13-14)23-11-4-9-19-23/h3-6,9,11,13,16-17H,1-2,7-8,10,12H2,(H2,20,21,24) |
| InChIKey | DXMIJAQUNVSOQU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |