C13H17N5O2 — CID 154845601
1-(3-methyl-1,2-oxazol-5-yl)-3-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]urea (PubChem CID 154845601) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-5-yl)-3-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]urea.
| Compound Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]urea |
|---|---|
| PubChem CID | 154845601 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]urea |
| SMILES | Cc1cc(NC(=O)N[C@@H]2CCC[C@@H]2n2cccn2)on1 |
| InChI | InChI=1S/C13H17N5O2/c1-9-8-12(20-17-9)16-13(19)15-10-4-2-5-11(10)18-7-3-6-14-18/h3,6-8,10-11H,2,4-5H2,1H3,(H2,15,16,19)/t10-,11+/m1/s1 |
| InChIKey | RAMOMJGQEFBUBG-MNOVXSKESA-N |
| XLogP | 2.09 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |