C18H24N4O — CID 95968799
3-(dimethylamino)-N-[(1S,2R)-2-pyrazol-1-ylcyclohexyl]benzamide (PubChem CID 95968799) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[(1S,2R)-2-pyrazol-1-ylcyclohexyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[(1S,2R)-2-pyrazol-1-ylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 95968799 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-(dimethylamino)-N-[(1S,2R)-2-pyrazol-1-ylcyclohexyl]benzamide |
| SMILES | CN(C)c1cccc(C(=O)N[C@H]2CCCC[C@H]2n2cccn2)c1 |
| InChI | InChI=1S/C18H24N4O/c1-21(2)15-8-5-7-14(13-15)18(23)20-16-9-3-4-10-17(16)22-12-6-11-19-22/h5-8,11-13,16-17H,3-4,9-10H2,1-2H3,(H,20,23)/t16-,17+/m0/s1 |
| InChIKey | IMKLASVFVSHSMK-DLBZAZTESA-N |
| XLogP | 2.86 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |