C17H20N4O4 — CID 99841643
3-methoxy-2-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]benzamide (PubChem CID 99841643) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 3-methoxy-2-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]benzamide.
| Compound Name | 3-methoxy-2-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 99841643 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3-methoxy-2-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]benzamide |
| SMILES | COc1cccc(C(=O)N[C@@H]2CCCC[C@H]2n2cccn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O4/c1-25-15-9-4-6-12(16(15)21(23)24)17(22)19-13-7-2-3-8-14(13)20-11-5-10-18-20/h4-6,9-11,13-14H,2-3,7-8H2,1H3,(H,19,22)/t13-,14-/m1/s1 |
| InChIKey | BMBJKUFVBLYGAM-ZIAGYGMSSA-N |
| XLogP | 2.71 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|