C15H20N6O3 — CID 124624705
5-ethyl-4-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]-1H-pyrazole-3-carboxamide (PubChem CID 124624705) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-ethyl-4-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-ethyl-4-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 124624705 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-ethyl-4-nitro-N-[(1R,2R)-2-pyrazol-1-ylcyclohexyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)N[C@@H]2CCCC[C@H]2n2cccn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N6O3/c1-2-10-14(21(23)24)13(19-18-10)15(22)17-11-6-3-4-7-12(11)20-9-5-8-16-20/h5,8-9,11-12H,2-4,6-7H2,1H3,(H,17,22)(H,18,19)/t11-,12-/m1/s1 |
| InChIKey | QXSJPFNWACUSQR-VXGBXAGGSA-N |
| XLogP | 1.99 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|