C15H22N6O — CID 86789203
1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(2-pyrazol-1-ylcyclohexyl)urea (PubChem CID 86789203) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(2-pyrazol-1-ylcyclohexyl)urea.
| Compound Name | 1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(2-pyrazol-1-ylcyclohexyl)urea |
|---|---|
| PubChem CID | 86789203 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[(5-methyl-1H-pyrazol-4-yl)methyl]-3-(2-pyrazol-1-ylcyclohexyl)urea |
| SMILES | Cc1[nH]ncc1CNC(=O)NC1CCCCC1n1cccn1 |
| InChI | InChI=1S/C15H22N6O/c1-11-12(10-17-20-11)9-16-15(22)19-13-5-2-3-6-14(13)21-8-4-7-18-21/h4,7-8,10,13-14H,2-3,5-6,9H2,1H3,(H,17,20)(H2,16,19,22) |
| InChIKey | ZXGZMRIOXDTEQZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |