C19H26N4O2 — CID 96566708
1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-pyrazol-1-ylcyclohexyl]urea (PubChem CID 96566708) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-pyrazol-1-ylcyclohexyl]urea.
| Compound Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-pyrazol-1-ylcyclohexyl]urea |
|---|---|
| PubChem CID | 96566708 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-pyrazol-1-ylcyclohexyl]urea |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)N[C@H]1CCCC[C@@H]1n1cccn1 |
| InChI | InChI=1S/C19H26N4O2/c24-14-16(13-15-7-2-1-3-8-15)21-19(25)22-17-9-4-5-10-18(17)23-12-6-11-20-23/h1-3,6-8,11-12,16-18,24H,4-5,9-10,13-14H2,(H2,21,22,25)/t16-,17-,18-/m0/s1 |
| InChIKey | FBKNVTVOKDQUEP-BZSNNMDCSA-N |
| XLogP | 2.27 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |