C17H26N2O3 — CID 95968425
1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-methoxycyclohexyl]urea (PubChem CID 95968425) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-methoxycyclohexyl]urea.
| Compound Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-methoxycyclohexyl]urea |
|---|---|
| PubChem CID | 95968425 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-[(1S,2S)-2-methoxycyclohexyl]urea |
| SMILES | CO[C@H]1CCCC[C@@H]1NC(=O)N[C@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H26N2O3/c1-22-16-10-6-5-9-15(16)19-17(21)18-14(12-20)11-13-7-3-2-4-8-13/h2-4,7-8,14-16,20H,5-6,9-12H2,1H3,(H2,18,19,21)/t14-,15-,16-/m0/s1 |
| InChIKey | CAFNKTHINKOAQG-JYJNAYRXSA-N |
| XLogP | 1.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |