C12H18N4O3S — CID 124625319
(5-ethyl-4-nitro-1H-pyrazol-3-yl)-[(5S)-5-methyl-1,4-thiazepan-4-yl]methanone (PubChem CID 124625319) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is (5-ethyl-4-nitro-1H-pyrazol-3-yl)-[(5S)-5-methyl-1,4-thiazepan-4-yl]methanone.
| Compound Name | (5-ethyl-4-nitro-1H-pyrazol-3-yl)-[(5S)-5-methyl-1,4-thiazepan-4-yl]methanone |
|---|---|
| PubChem CID | 124625319 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (5-ethyl-4-nitro-1H-pyrazol-3-yl)-[(5S)-5-methyl-1,4-thiazepan-4-yl]methanone |
| SMILES | CCc1[nH]nc(C(=O)N2CCSCC[C@@H]2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O3S/c1-3-9-11(16(18)19)10(14-13-9)12(17)15-5-7-20-6-4-8(15)2/h8H,3-7H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | VEFICPSDPJYXLS-QMMMGPOBSA-N |
| XLogP | 1.85 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|