C12H20ClN5O3 — CID 119579590
(3-methylpiperazin-1-yl)-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone;hydrochloride (PubChem CID 119579590) has the molecular formula C12H20ClN5O3 and a molecular weight of 317.78 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone;hydrochloride.
| Compound Name | (3-methylpiperazin-1-yl)-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119579590 |
| Molecular Formula | C12H20ClN5O3 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (3-methylpiperazin-1-yl)-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone;hydrochloride |
| SMILES | CCCc1[nH]nc(C(=O)N2CCNC(C)C2)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H19N5O3.ClH/c1-3-4-9-11(17(19)20)10(15-14-9)12(18)16-6-5-13-8(2)7-16;/h8,13H,3-7H2,1-2H3,(H,14,15);1H |
| InChIKey | LJECIPQMAJJFJX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|