C13H21N5O3 — CID 120810005
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone (PubChem CID 120810005) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 120810005 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(4-nitro-5-propyl-1H-pyrazol-3-yl)methanone |
| SMILES | CCCc1[nH]nc(C(=O)N2CCC(C)(CN)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O3/c1-3-4-9-11(18(20)21)10(16-15-9)12(19)17-6-5-13(2,7-14)8-17/h3-8,14H2,1-2H3,(H,15,16) |
| InChIKey | RQXGJLXLXKAHBA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|