C15H24N6O4 — CID 119481533
N-(2-aminoethyl)-1-(4-nitro-5-propyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxamide (PubChem CID 119481533) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-nitro-5-propyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(4-nitro-5-propyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119481533 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-nitro-5-propyl-1H-pyrazole-3-carbonyl)piperidine-3-carboxamide |
| SMILES | CCCc1[nH]nc(C(=O)N2CCCC(C(=O)NCCN)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H24N6O4/c1-2-4-11-13(21(24)25)12(19-18-11)15(23)20-8-3-5-10(9-20)14(22)17-7-6-16/h10H,2-9,16H2,1H3,(H,17,22)(H,18,19) |
| InChIKey | HETFXFKGHDMDDX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|