C16H27ClN6O4 — CID 119482394
N-(2-aminoethyl)-1-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119482394) has the molecular formula C16H27ClN6O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119482394 |
| Molecular Formula | C16H27ClN6O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2-aminoethyl)-1-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cc1nn(CCC(=O)N2CCCC(C(=O)NCCN)C2)c(C)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H26N6O4.ClH/c1-11-15(22(25)26)12(2)21(19-11)9-5-14(23)20-8-3-4-13(10-20)16(24)18-7-6-17;/h13H,3-10,17H2,1-2H3,(H,18,24);1H |
| InChIKey | XTXVUMAYIYTMGD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|