C9H12FN3O3 — CID 166262489
1-[(3R,4R)-4-fluorooxolan-3-yl]-3-(3-methyl-1,2-oxazol-5-yl)urea (PubChem CID 166262489) has the molecular formula C9H12FN3O3 and a molecular weight of 229.21 g/mol. Its IUPAC name is 1-[(3R,4R)-4-fluorooxolan-3-yl]-3-(3-methyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-[(3R,4R)-4-fluorooxolan-3-yl]-3-(3-methyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 166262489 |
| Molecular Formula | C9H12FN3O3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-[(3R,4R)-4-fluorooxolan-3-yl]-3-(3-methyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1cc(NC(=O)N[C@@H]2COC[C@@H]2F)on1 |
| InChI | InChI=1S/C9H12FN3O3/c1-5-2-8(16-13-5)12-9(14)11-7-4-15-3-6(7)10/h2,6-7H,3-4H2,1H3,(H2,11,12,14)/t6-,7+/m0/s1 |
| InChIKey | VXVCPIWKHGZWLT-NKWVEPMBSA-N |
| XLogP | 0.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |