C12H15N5OS — CID 154854688
1-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]-3-(1,2-thiazol-5-yl)urea (PubChem CID 154854688) has the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]-3-(1,2-thiazol-5-yl)urea.
| Compound Name | 1-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]-3-(1,2-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 154854688 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(1R,2S)-2-pyrazol-1-ylcyclopentyl]-3-(1,2-thiazol-5-yl)urea |
| SMILES | O=C(Nc1ccns1)N[C@@H]1CCC[C@@H]1n1cccn1 |
| InChI | InChI=1S/C12H15N5OS/c18-12(16-11-5-7-14-19-11)15-9-3-1-4-10(9)17-8-2-6-13-17/h2,5-10H,1,3-4H2,(H2,15,16,18)/t9-,10+/m1/s1 |
| InChIKey | FMCOVBKHDBJJDJ-ZJUUUORDSA-N |
| XLogP | 2.25 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |