C15H22N2O2S2 — CID 97215586
1-[(1R,2R)-2-methylsulfanylcyclohexyl]-3-[3-[(S)-methylsulfinyl]phenyl]urea (PubChem CID 97215586) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylsulfanylcyclohexyl]-3-[3-[(S)-methylsulfinyl]phenyl]urea.
| Compound Name | 1-[(1R,2R)-2-methylsulfanylcyclohexyl]-3-[3-[(S)-methylsulfinyl]phenyl]urea |
|---|---|
| PubChem CID | 97215586 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1-[(1R,2R)-2-methylsulfanylcyclohexyl]-3-[3-[(S)-methylsulfinyl]phenyl]urea |
| SMILES | CS[C@@H]1CCCC[C@H]1NC(=O)Nc1cccc([S@](C)=O)c1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-20-14-9-4-3-8-13(14)17-15(18)16-11-6-5-7-12(10-11)21(2)19/h5-7,10,13-14H,3-4,8-9H2,1-2H3,(H2,16,17,18)/t13-,14-,21+/m1/s1 |
| InChIKey | PQINHLYQYLKAQI-LKBUQDJMSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |