C11H21NOS — CID 131884719
N-[(1R,2R)-2-methylsulfanylcyclooctyl]acetamide (PubChem CID 131884719) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylsulfanylcyclooctyl]acetamide.
| Compound Name | N-[(1R,2R)-2-methylsulfanylcyclooctyl]acetamide |
|---|---|
| PubChem CID | 131884719 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-[(1R,2R)-2-methylsulfanylcyclooctyl]acetamide |
| SMILES | CS[C@@H]1CCCCCC[C@H]1NC(C)=O |
| InChI | InChI=1S/C11H21NOS/c1-9(13)12-10-7-5-3-4-6-8-11(10)14-2/h10-11H,3-8H2,1-2H3,(H,12,13)/t10-,11-/m1/s1 |
| InChIKey | AQHIHYPOOGGQPZ-GHMZBOCLSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |