C9H18N2OS — CID 103797253
(2S)-2-amino-N-(2-methylsulfanylcyclopentyl)propanamide (PubChem CID 103797253) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-methylsulfanylcyclopentyl)propanamide.
| Compound Name | (2S)-2-amino-N-(2-methylsulfanylcyclopentyl)propanamide |
|---|---|
| PubChem CID | 103797253 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (2S)-2-amino-N-(2-methylsulfanylcyclopentyl)propanamide |
| SMILES | CSC1CCCC1NC(=O)[C@H](C)N |
| InChI | InChI=1S/C9H18N2OS/c1-6(10)9(12)11-7-4-3-5-8(7)13-2/h6-8H,3-5,10H2,1-2H3,(H,11,12)/t6-,7?,8?/m0/s1 |
| InChIKey | UAHMGAOXHBAYMX-KKMMWDRVSA-N |
| XLogP | 0.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |