C13H27ClN2O — CID 119285417
2-amino-N-(2-tert-butylcyclohexyl)propanamide;hydrochloride (PubChem CID 119285417) has the molecular formula C13H27ClN2O and a molecular weight of 262.82 g/mol. Its IUPAC name is 2-amino-N-(2-tert-butylcyclohexyl)propanamide;hydrochloride.
| Compound Name | 2-amino-N-(2-tert-butylcyclohexyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119285417 |
| Molecular Formula | C13H27ClN2O |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-amino-N-(2-tert-butylcyclohexyl)propanamide;hydrochloride |
| SMILES | CC(N)C(=O)NC1CCCCC1C(C)(C)C.Cl |
| InChI | InChI=1S/C13H26N2O.ClH/c1-9(14)12(16)15-11-8-6-5-7-10(11)13(2,3)4;/h9-11H,5-8,14H2,1-4H3,(H,15,16);1H |
| InChIKey | XYFWPZAZPYHRTN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |