C8H16ClNO2 — CID 172759321
N-[(1R,2R)-2-hydroxycyclohexyl]acetamide;hydrochloride (PubChem CID 172759321) has the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]acetamide;hydrochloride.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 172759321 |
| Molecular Formula | C8H16ClNO2 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]acetamide;hydrochloride |
| SMILES | CC(=O)N[C@@H]1CCCC[C@H]1O.Cl |
| InChI | InChI=1S/C8H15NO2.ClH/c1-6(10)9-7-4-2-3-5-8(7)11;/h7-8,11H,2-5H2,1H3,(H,9,10);1H/t7-,8-;/m1./s1 |
| InChIKey | LLSXLNBZJRPNDA-SCLLHFNJSA-N |
| XLogP | 0.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |