C7H13NO2 — CID 14988808
N-[(1R,2S)-2-hydroxycyclopentyl]acetamide (PubChem CID 14988808) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is N-[(1R,2S)-2-hydroxycyclopentyl]acetamide.
| Compound Name | N-[(1R,2S)-2-hydroxycyclopentyl]acetamide |
|---|---|
| PubChem CID | 14988808 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-[(1R,2S)-2-hydroxycyclopentyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C7H13NO2/c1-5(9)8-6-3-2-4-7(6)10/h6-7,10H,2-4H2,1H3,(H,8,9)/t6-,7+/m1/s1 |
| InChIKey | WGWDTEAABXNFMD-RQJHMYQMSA-N |
| XLogP | 0.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |