C7H12INO — CID 138652376
N-[(1S,2S)-2-iodocyclopentyl]acetamide (PubChem CID 138652376) has the molecular formula C7H12INO and a molecular weight of 253.08 g/mol. Its IUPAC name is N-[(1S,2S)-2-iodocyclopentyl]acetamide.
| Compound Name | N-[(1S,2S)-2-iodocyclopentyl]acetamide |
|---|---|
| PubChem CID | 138652376 |
| Molecular Formula | C7H12INO |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | N-[(1S,2S)-2-iodocyclopentyl]acetamide |
| SMILES | CC(=O)N[C@H]1CCC[C@@H]1I |
| InChI | InChI=1S/C7H12INO/c1-5(10)9-7-4-2-3-6(7)8/h6-7H,2-4H2,1H3,(H,9,10)/t6-,7-/m0/s1 |
| InChIKey | ZDYDCQBJNKBFBB-BQBZGAKWSA-N |
| XLogP | 1.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|