C16H28N2O2Se — CID 10981236
N-[(1S,2S)-2-[(1S,2S)-2-acetamidocyclohexyl]selanylcyclohexyl]acetamide (PubChem CID 10981236) has the molecular formula C16H28N2O2Se and a molecular weight of 359.37 g/mol. Its IUPAC name is N-[(1S,2S)-2-[(1S,2S)-2-acetamidocyclohexyl]selanylcyclohexyl]acetamide.
| Compound Name | N-[(1S,2S)-2-[(1S,2S)-2-acetamidocyclohexyl]selanylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 10981236 |
| Molecular Formula | C16H28N2O2Se |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[(1S,2S)-2-[(1S,2S)-2-acetamidocyclohexyl]selanylcyclohexyl]acetamide |
| SMILES | CC(=O)N[C@H]1CCCC[C@@H]1[Se][C@H]1CCCC[C@@H]1NC(C)=O |
| InChI | InChI=1S/C16H28N2O2Se/c1-11(19)17-13-7-3-5-9-15(13)21-16-10-6-4-8-14(16)18-12(2)20/h13-16H,3-10H2,1-2H3,(H,17,19)(H,18,20)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | XCKFDYLNLUKIKH-VGWMRTNUSA-N |
| XLogP | 2.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|