C8H14ClNO — CID 18526491
N-[(2R)-2-chlorocyclohexyl]acetamide (PubChem CID 18526491) has the molecular formula C8H14ClNO and a molecular weight of 175.66 g/mol. Its IUPAC name is N-[(2R)-2-chlorocyclohexyl]acetamide.
| Compound Name | N-[(2R)-2-chlorocyclohexyl]acetamide |
|---|---|
| PubChem CID | 18526491 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-[(2R)-2-chlorocyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCCC[C@H]1Cl |
| InChI | InChI=1S/C8H14ClNO/c1-6(11)10-8-5-3-2-4-7(8)9/h7-8H,2-5H2,1H3,(H,10,11)/t7-,8?/m1/s1 |
| InChIKey | FDJBPALZTFVDEV-GVHYBUMESA-N |
| XLogP | 1.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|