C9H16ClNO — CID 166978311
N-[(1R,2S)-2-chloro-4-methylcyclohexyl]acetamide (PubChem CID 166978311) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is N-[(1R,2S)-2-chloro-4-methylcyclohexyl]acetamide.
| Compound Name | N-[(1R,2S)-2-chloro-4-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 166978311 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-[(1R,2S)-2-chloro-4-methylcyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC(C)C[C@@H]1Cl |
| InChI | InChI=1S/C9H16ClNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h6,8-9H,3-5H2,1-2H3,(H,11,12)/t6?,8-,9+/m0/s1 |
| InChIKey | UPVUTBLWLXAGAJ-TWSLBNPLSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|