C9H15ClO2 — CID 130961772
methyl (1S,2S,4R)-2-chloro-4-methylcyclohexane-1-carboxylate (PubChem CID 130961772) has the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. Its IUPAC name is methyl (1S,2S,4R)-2-chloro-4-methylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2S,4R)-2-chloro-4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 130961772 |
| Molecular Formula | C9H15ClO2 |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | methyl (1S,2S,4R)-2-chloro-4-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C)C[C@@H]1Cl |
| InChI | InChI=1S/C9H15ClO2/c1-6-3-4-7(8(10)5-6)9(11)12-2/h6-8H,3-5H2,1-2H3/t6-,7-,8+/m1/s1 |
| InChIKey | PKKPNMJZIGYKHF-PRJMDXOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|