C8H13NO3 — CID 163622472
methyl 2-acetamidocyclobutane-1-carboxylate (PubChem CID 163622472) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl 2-acetamidocyclobutane-1-carboxylate.
| Compound Name | methyl 2-acetamidocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 163622472 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | methyl 2-acetamidocyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CCC1NC(C)=O |
| InChI | InChI=1S/C8H13NO3/c1-5(10)9-7-4-3-6(7)8(11)12-2/h6-7H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | HPGZSQUXMZLSRX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |