C12H19NO5 — CID 11859526
dimethyl (1R,3S,4S)-4-acetamidocyclohexane-1,3-dicarboxylate (PubChem CID 11859526) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is dimethyl (1R,3S,4S)-4-acetamidocyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl (1R,3S,4S)-4-acetamidocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11859526 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | dimethyl (1R,3S,4S)-4-acetamidocyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](NC(C)=O)[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C12H19NO5/c1-7(14)13-10-5-4-8(11(15)17-2)6-9(10)12(16)18-3/h8-10H,4-6H2,1-3H3,(H,13,14)/t8-,9+,10+/m1/s1 |
| InChIKey | NNGFXNLBQKLDLV-UTLUCORTSA-N |
| XLogP | 0.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |