C18H33NO3 — CID 177480938
trans-methyl (1S,2S)-2-(dodecanoylamino)cyclobutane-1-carboxylate (PubChem CID 177480938) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(dodecanoylamino)cyclobutane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(dodecanoylamino)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 177480938 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | trans-methyl (1S,2S)-2-(dodecanoylamino)cyclobutane-1-carboxylate |
| SMILES | CCCCCCCCCCCC(=O)N[C@H]1CC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H33NO3/c1-3-4-5-6-7-8-9-10-11-12-17(20)19-16-14-13-15(16)18(21)22-2/h15-16H,3-14H2,1-2H3,(H,19,20)/t15-,16-/m0/s1 |
| InChIKey | VFWKZKIDYLCZNS-HOTGVXAUSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|