C15H30N2O — CID 103805764
N-[(1R,2R)-2-aminocyclohexyl]nonanamide (PubChem CID 103805764) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]nonanamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]nonanamide |
|---|---|
| PubChem CID | 103805764 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C15H30N2O/c1-2-3-4-5-6-7-12-15(18)17-14-11-9-8-10-13(14)16/h13-14H,2-12,16H2,1H3,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | DBNHVQDYPUAWEJ-ZIAGYGMSSA-N |
| XLogP | 3.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|