C11H22N2O2 — CID 103805745
N-[(1R,2R)-2-aminocyclohexyl]-3-ethoxypropanamide (PubChem CID 103805745) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-3-ethoxypropanamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 103805745 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C11H22N2O2/c1-2-15-8-7-11(14)13-10-6-4-3-5-9(10)12/h9-10H,2-8,12H2,1H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | KLOONMWQYLKTBP-NXEZZACHSA-N |
| XLogP | 0.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|