C9H16ClNOS — CID 51415768
S-ethyl N-[(1R,2R)-2-chlorocyclohexyl]carbamothioate (PubChem CID 51415768) has the molecular formula C9H16ClNOS and a molecular weight of 221.75 g/mol. Its IUPAC name is S-ethyl N-[(1R,2R)-2-chlorocyclohexyl]carbamothioate.
| Compound Name | S-ethyl N-[(1R,2R)-2-chlorocyclohexyl]carbamothioate |
|---|---|
| PubChem CID | 51415768 |
| Molecular Formula | C9H16ClNOS |
| Molecular Weight | 221.75 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | S-ethyl N-[(1R,2R)-2-chlorocyclohexyl]carbamothioate |
| SMILES | CCSC(=O)N[C@@H]1CCCC[C@H]1Cl |
| InChI | InChI=1S/C9H16ClNOS/c1-2-13-9(12)11-8-6-4-3-5-7(8)10/h7-8H,2-6H2,1H3,(H,11,12)/t7-,8-/m1/s1 |
| InChIKey | SCRPTDDKWJMCPI-HTQZYQBOSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|