C11H20N2OS — CID 90184216
S-ethyl N-[(2S,4E)-2-aminocyclooct-4-en-1-yl]carbamothioate (PubChem CID 90184216) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is S-ethyl N-[(2S,4E)-2-aminocyclooct-4-en-1-yl]carbamothioate.
| Compound Name | S-ethyl N-[(2S,4E)-2-aminocyclooct-4-en-1-yl]carbamothioate |
|---|---|
| PubChem CID | 90184216 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | S-ethyl N-[(2S,4E)-2-aminocyclooct-4-en-1-yl]carbamothioate |
| SMILES | CCSC(=O)NC1CCC/C=C\C[C@@H]1N |
| InChI | InChI=1S/C11H20N2OS/c1-2-15-11(14)13-10-8-6-4-3-5-7-9(10)12/h3,5,9-10H,2,4,6-8,12H2,1H3,(H,13,14)/b5-3-/t9-,10?/m0/s1 |
| InChIKey | ICMSYGXSTLSVQA-CUGTYAQZSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|