C9H16N2O2 — CID 147865429
(2-aminocyclooct-3-en-1-yl)carbamic acid (PubChem CID 147865429) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (2-aminocyclooct-3-en-1-yl)carbamic acid.
| Compound Name | (2-aminocyclooct-3-en-1-yl)carbamic acid |
|---|---|
| PubChem CID | 147865429 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (2-aminocyclooct-3-en-1-yl)carbamic acid |
| SMILES | NC1C=CCCCCC1NC(=O)O |
| InChI | InChI=1S/C9H16N2O2/c10-7-5-3-1-2-4-6-8(7)11-9(12)13/h3,5,7-8,11H,1-2,4,6,10H2,(H,12,13) |
| InChIKey | HXODPTXDPHPCPL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|