C8H16N2O2 — CID 124566826
[(1S,2R)-2-(aminomethyl)cyclohexyl]carbamic acid (PubChem CID 124566826) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is [(1S,2R)-2-(aminomethyl)cyclohexyl]carbamic acid.
| Compound Name | [(1S,2R)-2-(aminomethyl)cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 124566826 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | [(1S,2R)-2-(aminomethyl)cyclohexyl]carbamic acid |
| SMILES | NC[C@H]1CCCC[C@@H]1NC(=O)O |
| InChI | InChI=1S/C8H16N2O2/c9-5-6-3-1-2-4-7(6)10-8(11)12/h6-7,10H,1-5,9H2,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | QNQUHLMOZMVGFN-RQJHMYQMSA-N |
| XLogP | 0.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |