C7H15N3O — CID 94903973
[(1S,2R)-2-(aminomethyl)cyclopentyl]urea (PubChem CID 94903973) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is [(1S,2R)-2-(aminomethyl)cyclopentyl]urea.
| Compound Name | [(1S,2R)-2-(aminomethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 94903973 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | [(1S,2R)-2-(aminomethyl)cyclopentyl]urea |
| SMILES | NC[C@H]1CCC[C@@H]1NC(N)=O |
| InChI | InChI=1S/C7H15N3O/c8-4-5-2-1-3-6(5)10-7(9)11/h5-6H,1-4,8H2,(H3,9,10,11)/t5-,6+/m1/s1 |
| InChIKey | DAUMQTMEJQYCCL-RITPCOANSA-N |
| XLogP | -0.22 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |