C7H14N2O2 — CID 131092066
[(1R,2S)-2-(hydroxymethyl)cyclopentyl]urea (PubChem CID 131092066) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1R,2S)-2-(hydroxymethyl)cyclopentyl]urea.
| Compound Name | [(1R,2S)-2-(hydroxymethyl)cyclopentyl]urea |
|---|---|
| PubChem CID | 131092066 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | [(1R,2S)-2-(hydroxymethyl)cyclopentyl]urea |
| SMILES | NC(=O)N[C@@H]1CCC[C@@H]1CO |
| InChI | InChI=1S/C7H14N2O2/c8-7(11)9-6-3-1-2-5(6)4-10/h5-6,10H,1-4H2,(H3,8,9,11)/t5-,6-/m1/s1 |
| InChIKey | RTNCMUCYHPKMBG-PHDIDXHHSA-N |
| XLogP | -0.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |