C13H24N2OS — CID 118459011
S-tert-butyl N-[(1R,2R,3E)-2-aminocyclooct-3-en-1-yl]carbamothioate (PubChem CID 118459011) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is S-tert-butyl N-[(1R,2R,3E)-2-aminocyclooct-3-en-1-yl]carbamothioate.
| Compound Name | S-tert-butyl N-[(1R,2R,3E)-2-aminocyclooct-3-en-1-yl]carbamothioate |
|---|---|
| PubChem CID | 118459011 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | S-tert-butyl N-[(1R,2R,3E)-2-aminocyclooct-3-en-1-yl]carbamothioate |
| SMILES | CC(C)(C)SC(=O)N[C@@H]1CCCC/C=C\[C@H]1N |
| InChI | InChI=1S/C13H24N2OS/c1-13(2,3)17-12(16)15-11-9-7-5-4-6-8-10(11)14/h6,8,10-11H,4-5,7,9,14H2,1-3H3,(H,15,16)/b8-6-/t10-,11-/m1/s1 |
| InChIKey | CNFIADTZUGBGFG-JRJMJSEMSA-N |
| XLogP | 3.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|