C13H24N2O2 — CID 118459009
tert-butyl N-[(1R,2E,8R)-8-aminocyclooct-2-en-1-yl]carbamate (PubChem CID 118459009) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is tert-butyl N-[(1R,2E,8R)-8-aminocyclooct-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2E,8R)-8-aminocyclooct-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 118459009 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | tert-butyl N-[(1R,2E,8R)-8-aminocyclooct-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1/C=C\CCCC[C@H]1N |
| InChI | InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-11-9-7-5-4-6-8-10(11)14/h7,9-11H,4-6,8,14H2,1-3H3,(H,15,16)/b9-7-/t10-,11-/m1/s1 |
| InChIKey | PMZNJCHQWWYGGA-ZNWQGHSCSA-N |
| XLogP | 2.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|