C11H22N2O3 — CID 70952812
tert-butyl N-[(1R,2R,3S)-2-amino-3-hydroxycyclohexyl]carbamate (PubChem CID 70952812) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3S)-2-amino-3-hydroxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3S)-2-amino-3-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 70952812 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | tert-butyl N-[(1R,2R,3S)-2-amino-3-hydroxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)13-7-5-4-6-8(14)9(7)12/h7-9,14H,4-6,12H2,1-3H3,(H,13,15)/t7-,8+,9-/m1/s1 |
| InChIKey | ZAGYHLVELOMOSN-HRDYMLBCSA-N |
| XLogP | 0.75 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |