C10H20N2O3 — CID 129395964
tert-butyl N-[(1R,2S)-2-aminooxycyclopentyl]carbamate (PubChem CID 129395964) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-aminooxycyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-aminooxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 129395964 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-aminooxycyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H]1ON |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,3)14-9(13)12-7-5-4-6-8(7)15-11/h7-8H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | PBKJVKIOXZUQTI-SFYZADRCSA-N |
| XLogP | 1.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|