C18H32N2O2S — CID 122495770
S-tert-butyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate (PubChem CID 122495770) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is S-tert-butyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate.
| Compound Name | S-tert-butyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate |
|---|---|
| PubChem CID | 122495770 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | S-tert-butyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate |
| SMILES | CC(C)(C)SC(=O)NC1/C=C\C(NC(=O)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C18H32N2O2S/c1-17(2,3)15(21)19-13-9-7-8-10-14(12-11-13)20-16(22)23-18(4,5)6/h11-14H,7-10H2,1-6H3,(H,19,21)(H,20,22)/b12-11- |
| InChIKey | JINFKULRMIIURK-QXMHVHEDSA-N |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|