C15H26N2O2S — CID 122495928
S-methyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate (PubChem CID 122495928) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is S-methyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate.
| Compound Name | S-methyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate |
|---|---|
| PubChem CID | 122495928 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | S-methyl N-[(2E)-4-(2,2-dimethylpropanoylamino)cyclooct-2-en-1-yl]carbamothioate |
| SMILES | CSC(=O)NC1/C=C\C(NC(=O)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C15H26N2O2S/c1-15(2,3)13(18)16-11-7-5-6-8-12(10-9-11)17-14(19)20-4/h9-12H,5-8H2,1-4H3,(H,16,18)(H,17,19)/b10-9- |
| InChIKey | SZFQPGPFXNMNNO-KTKRTIGZSA-N |
| XLogP | 3.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|