C9H12Cl3NO — CID 158442389
2,2,2-trichloro-N-[(1R)-cyclohept-2-en-1-yl]acetamide (PubChem CID 158442389) has the molecular formula C9H12Cl3NO and a molecular weight of 256.56 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R)-cyclohept-2-en-1-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R)-cyclohept-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 158442389 |
| Molecular Formula | C9H12Cl3NO |
| Molecular Weight | 256.56 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R)-cyclohept-2-en-1-yl]acetamide |
| SMILES | O=C(N[C@H]1C=CCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3NO/c10-9(11,12)8(14)13-7-5-3-1-2-4-6-7/h3,5,7H,1-2,4,6H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | SQTUITRGXIONNT-ZETCQYMHSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|