C13H22N4O2S — CID 88816684
methyl N-[[(2Z)-cyclooct-2-en-1-yl]carbamoyl]-N'-(methylcarbamoyl)carbamimidothioate (PubChem CID 88816684) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is methyl N-[[(2Z)-cyclooct-2-en-1-yl]carbamoyl]-N'-(methylcarbamoyl)carbamimidothioate.
| Compound Name | methyl N-[[(2Z)-cyclooct-2-en-1-yl]carbamoyl]-N'-(methylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 88816684 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methyl N-[[(2Z)-cyclooct-2-en-1-yl]carbamoyl]-N'-(methylcarbamoyl)carbamimidothioate |
| SMILES | CNC(=O)N=C(NC(=O)NC1/C=C\CCCCC1)SC |
| InChI | InChI=1S/C13H22N4O2S/c1-14-11(18)16-13(20-2)17-12(19)15-10-8-6-4-3-5-7-9-10/h6,8,10H,3-5,7,9H2,1-2H3,(H3,14,15,16,17,18,19)/b8-6- |
| InChIKey | VWPRYEWAWOLROW-VURMDHGXSA-N |
| XLogP | 2.23 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|