C12H20N2OS — CID 163704728
methyl N-acetyl-N'-[1-[(1R)-cyclohex-2-en-1-yl]ethyl]carbamimidothioate (PubChem CID 163704728) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is methyl N-acetyl-N'-[1-[(1R)-cyclohex-2-en-1-yl]ethyl]carbamimidothioate.
| Compound Name | methyl N-acetyl-N'-[1-[(1R)-cyclohex-2-en-1-yl]ethyl]carbamimidothioate |
|---|---|
| PubChem CID | 163704728 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | methyl N-acetyl-N'-[1-[(1R)-cyclohex-2-en-1-yl]ethyl]carbamimidothioate |
| SMILES | CS/C(=N\C(C)[C@H]1C=CCCC1)NC(C)=O |
| InChI | InChI=1S/C12H20N2OS/c1-9(11-7-5-4-6-8-11)13-12(16-3)14-10(2)15/h5,7,9,11H,4,6,8H2,1-3H3,(H,13,14,15)/t9?,11-/m0/s1 |
| InChIKey | KECDYJQLQUSLLB-UMJHXOGRSA-N |
| XLogP | 2.59 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|